AP Chemistry Chapter 15 Jeopardy

AP ChemistryAP ChemistryChapter 15 JeopardyChapter 15 Jeopardy

Jennie L. BordersJennie L. Borders

Round 1 – Chapter 15 Round 1 – Chapter 15

KK QQCalculating Calculating Equilibrium Equilibrium ConstantsConstants

Applications Applications of kof k

Le Le Chatelier’s Chatelier’s PrinciplePrinciple

SurpriseSurprise

100 100 100 100 100 100

200 200 200 200 200 200

300 300 300 300 300 300

400 400 400 400 400 400

500 500 500 500 500 500

k 100k 100Write the equilibrium constant Write the equilibrium constant

expression for the following expression for the following reaction:reaction:

2C2C22HH4(g)4(g) + 2H + 2H22OO(g)(g) 2C 2C22HH6(g)6(g) + O + O2(g)2(g)

KKcc = = [C [C22HH66]]22[O[O22] ]

[C[C22HH44]]22[H[H22O]O]22

k 200k 200

Write the equilibrium constant Write the equilibrium constant expression for the following expression for the following

reaction:reaction:

4HCl4HCl(aq)(aq) + O + O2(g)2(g) 2H 2H22OO(l)(l) + 2Cl + 2Cl2(g)2(g)

KKcc = = [Cl [Cl22]]22__

[HCl][HCl]44[O[O22]]

k 300k 300Does the following reaction favor Does the following reaction favor

the production or reactants or the production or reactants or products?products?

2HBr2HBr(g)(g) H H2(g) 2(g) + Br+ Br2(g)2(g)

KKcc = 5.8 x 10 = 5.8 x 10-18-18

reactantsreactants

k 400k 400

Calculate KCalculate Kcc at 303K for SO at 303K for SO2(g)2(g) + +

ClCl2(g)2(g) SO SO22ClCl2(g)2(g) if K if Kpp = 34.5 at = 34.5 at

the temperature.the temperature.

858.23858.23

k 500k 500Consider the equilibriumConsider the equilibrium

NN22 + O + O22 + Br + Br22 2NOBr 2NOBr

Calculate the equilibrium constant KCalculate the equilibrium constant Kpp

for this reaction, given the following for this reaction, given the following information at 298K:information at 298K:

2NO + Br2NO + Br22 2NOBr K 2NOBr Kcc = 2.0 = 2.0

2NO 2NO N N22 + O + O22 K Kcc = 2.1 x 10 = 2.1 x 103030

KKpp = 3.76 x 10 = 3.76 x 10-32-32

Q 100Q 100

If QIf Qcc > K > Kcc, how must the reaction , how must the reaction

proceed to reach equilibrium?proceed to reach equilibrium?

leftleft

Q 200Q 200

What is the difference between Q What is the difference between Q and K?and K?

K uses equilibrium concentrations K uses equilibrium concentrations or partial pressures and Q uses or partial pressures and Q uses

concentrations or partial pressures concentrations or partial pressures at any time.at any time.

Q 300Q 300KKpp for the equilibrium N for the equilibrium N2(g)2(g) + 3H + 3H2(g)2(g)

2NH2NH3(g) 3(g) is 4.51 x 10is 4.51 x 10-5-5 at 450 at 450ooC. Indicate C. Indicate

whether the mixture is at equilibrium. If whether the mixture is at equilibrium. If it is not at equilibrium, indicate the it is not at equilibrium, indicate the

direction in which the reaction must direction in which the reaction must shift to achieve equilibrium.shift to achieve equilibrium.

98 atm NH98 atm NH33, 45 atm N, 45 atm N22, 55 atm H, 55 atm H22

1.28 x 101.28 x 10-3-3 shifts to the left shifts to the left


2NH2NH3(g) 3(g) is 4.51 x 10is 4.51 x 10-5-5 at 450 at 450ooC. Indicate C. Indicate

whether the mixture is at equilibrium. If whether the mixture is at equilibrium. If it is not at equilibrium, indicate the it is not at equilibrium, indicate the

direction in which the reaction must direction in which the reaction must shift to achieve equilibrium.shift to achieve equilibrium.

57 atm NH57 atm NH33, 143 atm N, 143 atm N22, and no H, and no H22

0 in denominator, shifts to the left0 in denominator, shifts to the left


2NH2NH3(g) 3(g) is 4.51 x 10is 4.51 x 10-5-5 at 450 at 450ooC. C.

Indicate whether the mixture is at Indicate whether the mixture is at equilibrium. If it is not at equilibrium, equilibrium. If it is not at equilibrium,

indicate the direction in which the indicate the direction in which the reaction must shift to achieve reaction must shift to achieve

equilibrium.equilibrium.

13 atm NH13 atm NH33, 27 atm N, 27 atm N22, and 82 atm H, and 82 atm H22

1.14 x 101.14 x 10-5-5 shifts to the right shifts to the right

Calculating Equilibrium Calculating Equilibrium Constants 100Constants 100

An equilibrium mixture in a 2L An equilibrium mixture in a 2L vessel is found to contain 0.0406 vessel is found to contain 0.0406 mol CHmol CH33OH, 0.170 mol CO, and OH, 0.170 mol CO, and

0.302 mol H0.302 mol H22 at 500K. Calculate at 500K. Calculate

KKcc at this temperature. at this temperature.

COCO(g)(g) + 2H + 2H2(g)2(g) CH CH33OHOH(g)(g)

10.4710.47


The equilibrium NOThe equilibrium NO(g)(g) + Cl + Cl2(g)2(g)

NoClNoCl(g)(g) is established at 500K. An is established at 500K. An

equilibrium mixture of the three equilibrium mixture of the three gases has partial pressures of 0.095 gases has partial pressures of 0.095 atm NO, 0.171 atm Clatm NO, 0.171 atm Cl22, and 0.28 atm , and 0.28 atm

NOCl. Calculate KNOCl. Calculate Kpp for this reaction for this reaction50.850.8


A flask contains 1.5 atm NA flask contains 1.5 atm N22OO44 and 1 and 1

atm NOatm NO22 and the following and the following

equilibrium is achieved Nequilibrium is achieved N22OO4(g)4(g)

2NO2NO2(g)2(g). After equilibrium is . After equilibrium is

reached, the partial pressure of reached, the partial pressure of NONO22 is 0.512 atm. Calculate the is 0.512 atm. Calculate the

value of Kvalue of Kpp for this reaction. for this reaction.0.15030.1503


A mixture of 0.2 mol COA mixture of 0.2 mol CO22, 0.1 mol H, 0.1 mol H22, ,

and 0.16 mol Hand 0.16 mol H22O is placed in a 2L O is placed in a 2L

vessel. The following equilibrium is vessel. The following equilibrium is established: COestablished: CO2(g)2(g) + H+ H2(g)2(g)

COCO(g) (g) + H+ H22OO(g)(g). At equilibrium P. At equilibrium PH2OH2O = =

3.51 atm. Calculate K3.51 atm. Calculate Kpp for the for the

reaction at 500K.reaction at 500K.0.110.11


A mixture of 1.374g HA mixture of 1.374g H22 and 70.31g and 70.31g

BrBr22 is heated in a 2L vessel at is heated in a 2L vessel at

700K. These substances react as 700K. These substances react as follows: Hfollows: H2(g)2(g) + Br + Br2(g)2(g) 2HBr 2HBr(g)(g). At . At

equilibrium the vessel is found to equilibrium the vessel is found to contain 0.566g of Hcontain 0.566g of H22. Calculate K. Calculate Kcc..

67.6167.61

Applications of k 100Applications of k 100

At 100At 100ooC, KC, Kcc = 0.078 for the reaction = 0.078 for the reaction

SOSO22ClCl2(g) 2(g) SO SO2(g) 2(g) + Cl+ Cl2(g)2(g). In an . In an

equilibrium mixture of the three gases, equilibrium mixture of the three gases, the concentrations of SOthe concentrations of SO22ClCl2 2 is 0.180M is 0.180M

and SOand SO22 is 0.052M. What is the is 0.052M. What is the

concentration of Clconcentration of Cl22 in the equilibrium in the equilibrium

mixture?mixture?0.162M0.162M


At 900K the following reaction has KAt 900K the following reaction has Kpp = =

0.345: 2SO0.345: 2SO2(g) 2(g) ++ OO2(g) 2(g) 2SO 2SO3(g)3(g). In . In

an equilibrium mixture the partial an equilibrium mixture the partial pressures of SOpressures of SO22 is 0.135 atm and O is 0.135 atm and O22

is 0.455 atm. What is the equilibrium is 0.455 atm. What is the equilibrium partial pressure of SOpartial pressure of SO33 in the mixture? in the mixture?

0.054 atm0.054 atm


At 373K, KAt 373K, Kpp = 0.416 for the equilibrium = 0.416 for the equilibrium

2NOBr2NOBr(g) (g) 2NO 2NO(g) (g) + Br+ Br2(g)2(g). If the . If the

pressures of NOBrpressures of NOBr(g) (g) and NOand NO(g) (g) are are

equal, what is the equilibrium equal, what is the equilibrium pressure of Brpressure of Br2(g)2(g)??

0.416 atm0.416 atm


At 218At 218ooC, KC, Kcc = 1.2 x 10 = 1.2 x 10-4-4 for the for the

equilibrium NHequilibrium NH44HSHS(s)(s) NH NH3(g) 3(g) + +

HH22SS(g)(g). Calculate the equilibrium . Calculate the equilibrium

concentrations of NHconcentrations of NH33 and H and H22S if a S if a

sample of solid NHsample of solid NH44HS is placed in a HS is placed in a

closed vessel and decomposes until closed vessel and decomposes until equilibrium is reached.equilibrium is reached.

[NH[NH33] = 0.011M, [H] = 0.011M, [H22S] = 0.011MS] = 0.011M


For the equilibrium BrFor the equilibrium Br22 + Cl + Cl22 2BrCl 2BrCl

at 400K, Kat 400K, Kcc = 7.0. If 0.2 mol Br = 7.0. If 0.2 mol Br22 and and

0.25 mol Cl0.25 mol Cl22 are introduced into a 1L are introduced into a 1L

container at 400K, what will be the container at 400K, what will be the equilibrium concentrations of Brequilibrium concentrations of Br22, Cl, Cl22, ,

and BrCl?and BrCl?[Br[Br22] = 0.073 M, [Cl] = 0.073 M, [Cl22] = 0.123 M, ] = 0.123 M,

[BrCl] = 0.254 M[BrCl] = 0.254 M

Le Chatelier’s Principle 100Le Chatelier’s Principle 100Consider 4NHConsider 4NH3(g) 3(g) + O+ O2(g) 2(g) 4NO 4NO(g) (g)

+6H+6H22OO(g)(g), , H = -904.4kJ. How does H = -904.4kJ. How does

increasing [NHincreasing [NH33] affect the yield of ] affect the yield of

NO at equilibrium?NO at equilibrium?

Equilibrium shifts to the right, Equilibrium shifts to the right, so [NO] increases. so [NO] increases.

Le Chatelier’s Principle 200Le Chatelier’s Principle 200

Consider 4NHConsider 4NH3(g) 3(g) + O+ O2(g) 2(g) 4NO 4NO(g) (g)


decreasing [Odecreasing [O22] affect the yield of ] affect the yield of

NO at equilibrium?NO at equilibrium? Equilibrium shifts to the left, so Equilibrium shifts to the left, so

[NO] decreases.[NO] decreases.




decreasing the volume of the decreasing the volume of the container in which the reaction container in which the reaction occurs affect the yield of NO at occurs affect the yield of NO at

equilibrium?equilibrium?Equilibrium shifts to the left, so Equilibrium shifts to the left, so

[NO] decreses.[NO] decreses.




adding a catalyst affect the yield of adding a catalyst affect the yield of NO at equilibrium?NO at equilibrium?

No shift in equilibrium, so No shift in equilibrium, so no change in [NO].no change in [NO].




increasing temperature affect the increasing temperature affect the yield of NO at equilibrium?yield of NO at equilibrium?

Equilibrium shifts to the left, so Equilibrium shifts to the left, so [NO] decreases.[NO] decreases.

Surprise 100Surprise 100

At 1000K, KAt 1000K, Kpp = 1.85 for the reaction = 1.85 for the reaction

SOSO2(g)2(g) + 1/2O + 1/2O2(g)2(g) SO SO3(g)3(g). What . What

is the value of Kis the value of Kpp for the reaction for the reaction

SOSO3(g)3(g) SO SO2(g) 2(g) + 1/2O+ 1/2O2(g)2(g)??

0.5410.541


Consider the following equilibrium: Consider the following equilibrium: 2H2H2(g)2(g) + S + S2(g)2(g) 2H 2H22SS(g) (g) KKcc = 1.08 = 1.08

x 10x 1077 at 700 at 700ooC. Does the C. Does the equilibrium mixture contain mostly equilibrium mixture contain mostly

HH22 and S and S22 or mostly H or mostly H22S?S?

HH22SS


When 2.00 mol of SOWhen 2.00 mol of SO22ClCl22 is placed in is placed in

a 2L flask at 303K, 56% of the a 2L flask at 303K, 56% of the SOSO22ClCl22 decomposes to SO decomposes to SO22 and and

ClCl22: SO: SO22ClCl2(g)2(g) SO SO2(g) 2(g) + Cl+ Cl2(g)2(g). .

Calculate KCalculate Kcc for this reaction at this for this reaction at this

temperature.temperature.0.7130.713

Surprise 400Surprise 400A mixture of CHA mixture of CH44 and H and H22O is passed O is passed

over a nickel catalyst at 1000K. over a nickel catalyst at 1000K. The emerging gas is collected in a The emerging gas is collected in a

5L falsk and is found to contain 5L falsk and is found to contain 8.62g CO, 2.6g H8.62g CO, 2.6g H22, 43g CH, 43g CH44, and , and

48.4g H48.4g H22O. Assuming that O. Assuming that

equilibrium has been reached, equilibrium has been reached, calculate Kcalculate Kcc for the reaction. for the reaction.

3.74 x 103.74 x 10-3-3

Surprise 500Surprise 500At 80At 80ooC, KC, Kcc = 1.87 x 10 = 1.87 x 10-3-3 for the for the

reaction PHreaction PH33BClBCl3(s)3(s) PH PH3(g) 3(g) + +

BClBCl3(g)3(g). Calculate the equilibrium . Calculate the equilibrium

concentrations of PHconcentrations of PH33 and BCl and BCl33 if a if a

solid sample of PHsolid sample of PH33BClBCl33 is placed is placed

in a closed vessel and in a closed vessel and decomposes until equilibrium is decomposes until equilibrium is

reached.reached.[PH[PH33] = 0.043M, [BCl] = 0.043M, [BCl33] = 0.043M] = 0.043M

AP Chemistry Chapter 15 Jeopardy

Documents

Transcript of AP Chemistry Chapter 15 Jeopardy